| Name | 3-Chlorophenylacetic acid |
| Synonyms | 3-chloroacetate 3-- acetic acid (3-chlorophenyl)acetate Between the acid chloride 3-Chloropnenylacetic Acid 3-Chlorophenylacetic acid M-chlorophenylacetic acid meta chlorophenylacetic acid 2-(3-chlorophenyl)acetic acid Acetic acid, (m-chlorophenyl)- ceticacid, (M-chlorophenyl)- (7CI,8CI) |
| CAS | 1878-65-5 |
| EINECS | 217-520-0 |
| InChI | InChI=1/C8H7ClO2/c9-7-3-1-2-6(4-7)5-8(10)11/h1-4H,5H2,(H,10,11)/p-1 |
| Molecular Formula | C8H7ClO2 |
| Molar Mass | 170.59 |
| Density | 1.2315 (rough estimate) |
| Melting Point | 76-79 °C (lit.) |
| Boling Point | 241.44°C (rough estimate) |
| Flash Point | 131.7°C |
| Solubility | methanol: 0.1g/mL, clear, colorless |
| Vapor Presure | 0.000751mmHg at 25°C |
| Appearance | White glossy flakes or lumps |
| Color | White |
| BRN | 2045103 |
| pKa | 4.14(at 25℃) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.5660 (estimate) |
| MDL | MFCD00004332 |
| Physical and Chemical Properties | Melting point 77-80°C |
| Use | Used as a pharmaceutical Intermediate |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| HS Code | 29163900 |
| Hazard Note | Irritant |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| Uses | Used as a pharmaceutical intermediate 3-chlorophenylacetic acid is used to make pharmaceutical intermediates. |